About [5-fluoro-2-[2-[(methyl-oxo-pyridin-2-yl-λ6-sulfanylidene)amino]-2-oxoethyl]phenyl] acetate
[5-fluoro-2-[2-[(methyl-oxo-pyridin-2-yl-λ6-sulfanylidene)amino]-2-oxoethyl]phenyl] acetate (PubChem CID 135067043) has the molecular formula C16H15FN2O4S
and a molecular weight of 350.37 g/mol. Its IUPAC name is [5-fluoro-2-[2-[(methyl-oxo-pyridin-2-yl-λ6-sulfanylidene)amino]-2-oxoethyl]phenyl] acetate.
Molecular Properties
| Compound Name | [5-fluoro-2-[2-[(methyl-oxo-pyridin-2-yl-λ6-sulfanylidene)amino]-2-oxoethyl]phenyl] acetate |
| PubChem CID | 135067043 |
| Molecular Formula | C16H15FN2O4S |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | [5-fluoro-2-[2-[(methyl-oxo-pyridin-2-yl-λ6-sulfanylidene)amino]-2-oxoethyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cc(F)ccc1CC(=O)N=S(C)(=O)c1ccccn1 |
| InChI | InChI=1S/C16H15FN2O4S/c1-11(20)23-14-10-13(17)7-6-12(14)9-15(21)19-24(2,22)16-5-3-4-8-18-16/h3-8,10H,9H2,1-2H3 |
| InChIKey | UTNTXNMKUOLOPZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 85.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [5-fluoro-2-[2-[(methyl-oxo-pyridin-2-yl-λ6-sulfanylidene)amino]-2-oxoethyl]phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-fluoro-2-[2-[(methyl-oxo-pyridin-2-yl-λ6-sulfanylidene)amino]-2-oxoethyl]phenyl] acetate?
The IUPAC name of [5-fluoro-2-[2-[(methyl-oxo-pyridin-2-yl-λ6-sulfanylidene)amino]-2-oxoethyl]phenyl] acetate (CID 135067043) is [5-fluoro-2-[2-[(methyl-oxo-pyridin-2-yl-λ6-sulfanylidene)amino]-2-oxoethyl]phenyl] acetate.
What is the SMILES notation for [5-fluoro-2-[2-[(methyl-oxo-pyridin-2-yl-λ6-sulfanylidene)amino]-2-oxoethyl]phenyl] acetate?
The canonical SMILES for [5-fluoro-2-[2-[(methyl-oxo-pyridin-2-yl-λ6-sulfanylidene)amino]-2-oxoethyl]phenyl] acetate is CC(=O)Oc1cc(F)ccc1CC(=O)N=S(C)(=O)c1ccccn1.
What is the InChIKey of [5-fluoro-2-[2-[(methyl-oxo-pyridin-2-yl-λ6-sulfanylidene)amino]-2-oxoethyl]phenyl] acetate?
The InChIKey is UTNTXNMKUOLOPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15FN2O4S/c1-11(20)23-14-10-13(17)7-6-12(14)9-15(21)19-24(2,22)16-5-3-4-8-18-16/h3-8,10H,9H2,1-2H3.
What are the key properties of [5-fluoro-2-[2-[(methyl-oxo-pyridin-2-yl-λ6-sulfanylidene)amino]-2-oxoethyl]phenyl] acetate?
[5-fluoro-2-[2-[(methyl-oxo-pyridin-2-yl-λ6-sulfanylidene)amino]-2-oxoethyl]phenyl] acetate has a molecular weight of 350.37 g/mol, XLogP of 2.37, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-fluoro-2-[2-[(methyl-oxo-pyridin-2-yl-λ6-sulfanylidene)amino]-2-oxoethyl]phenyl] acetate is sourced from PubChem (CID 135067043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).