C19H19ClN2O4S — CID 135069265
[5-chloro-2-[1-[(methyl-oxo-pyridin-2-yl-λ6-sulfanylidene)carbamoyl]cyclobutyl]phenyl] acetate (PubChem CID 135069265) has the molecular formula C19H19ClN2O4S and a molecular weight of 406.89 g/mol. Its IUPAC name is [5-chloro-2-[1-[(methyl-oxo-pyridin-2-yl-λ6-sulfanylidene)carbamoyl]cyclobutyl]phenyl] acetate.
| Compound Name | [5-chloro-2-[1-[(methyl-oxo-pyridin-2-yl-λ6-sulfanylidene)carbamoyl]cyclobutyl]phenyl] acetate |
|---|---|
| PubChem CID | 135069265 |
| Molecular Formula | C19H19ClN2O4S |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | [5-chloro-2-[1-[(methyl-oxo-pyridin-2-yl-λ6-sulfanylidene)carbamoyl]cyclobutyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cc(Cl)ccc1C1(C(=O)N=S(C)(=O)c2ccccn2)CCC1 |
| InChI | InChI=1S/C19H19ClN2O4S/c1-13(23)26-16-12-14(20)7-8-15(16)19(9-5-10-19)18(24)22-27(2,25)17-6-3-4-11-21-17/h3-4,6-8,11-12H,5,9-10H2,1-2H3 |
| InChIKey | JSQZBBQVOLQEFV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 85.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|