C33H28F3NO2 — CID 135067673
1,2-bis(4-methoxyphenyl)-6-methyl-4-phenyl-3-[4-(trifluoromethyl)phenyl]-2H-pyridine (PubChem CID 135067673) has the molecular formula C33H28F3NO2 and a molecular weight of 527.59 g/mol. Its IUPAC name is 1,2-bis(4-methoxyphenyl)-6-methyl-4-phenyl-3-[4-(trifluoromethyl)phenyl]-2H-pyridine.
| Compound Name | 1,2-bis(4-methoxyphenyl)-6-methyl-4-phenyl-3-[4-(trifluoromethyl)phenyl]-2H-pyridine |
|---|---|
| PubChem CID | 135067673 |
| Molecular Formula | C33H28F3NO2 |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | 1,2-bis(4-methoxyphenyl)-6-methyl-4-phenyl-3-[4-(trifluoromethyl)phenyl]-2H-pyridine |
| SMILES | COc1ccc(C2C(c3ccc(C(F)(F)F)cc3)=C(c3ccccc3)C=C(C)N2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C33H28F3NO2/c1-22-21-30(23-7-5-4-6-8-23)31(24-9-13-26(14-10-24)33(34,35)36)32(25-11-17-28(38-2)18-12-25)37(22)27-15-19-29(39-3)20-16-27/h4-21,32H,1-3H3 |
| InChIKey | OXMSORYFQVGHSS-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|