C36H31F3N4O2 — CID 135067850
2-[(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethoxy]-N-quinolin-8-yl-5-(trifluoromethyl)benzamide (PubChem CID 135067850) has the molecular formula C36H31F3N4O2 and a molecular weight of 608.66 g/mol. Its IUPAC name is 2-[(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethoxy]-N-quinolin-8-yl-5-(trifluoromethyl)benzamide.
| Compound Name | 2-[(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethoxy]-N-quinolin-8-yl-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 135067850 |
| Molecular Formula | C36H31F3N4O2 |
| Molecular Weight | 608.66 g/mol |
| Exact Mass | 608.24 |
| IUPAC Name | 2-[(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethoxy]-N-quinolin-8-yl-5-(trifluoromethyl)benzamide |
| SMILES | C=CC1CN2CCC1CC2C(Oc1ccc(C(F)(F)F)cc1C(=O)Nc1cccc2cccnc12)c1ccnc2ccccc12 |
| InChI | InChI=1S/C36H31F3N4O2/c1-2-22-21-43-18-15-24(22)19-31(43)34(27-14-17-40-29-10-4-3-9-26(27)29)45-32-13-12-25(36(37,38)39)20-28(32)35(44)42-30-11-5-7-23-8-6-16-41-33(23)30/h2-14,16-17,20,22,24,31,34H,1,15,18-19,21H2,(H,42,44) |
| InChIKey | KPDLUWZQNBVOBW-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.66 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|