C9H12F2O2 — CID 135068101
3-(1,1-difluoro-2-oxopropyl)cyclohexan-1-one (PubChem CID 135068101) has the molecular formula C9H12F2O2 and a molecular weight of 190.19 g/mol. Its IUPAC name is 3-(1,1-difluoro-2-oxopropyl)cyclohexan-1-one.
| Compound Name | 3-(1,1-difluoro-2-oxopropyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 135068101 |
| Molecular Formula | C9H12F2O2 |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 3-(1,1-difluoro-2-oxopropyl)cyclohexan-1-one |
| SMILES | CC(=O)C(F)(F)C1CCCC(=O)C1 |
| InChI | InChI=1S/C9H12F2O2/c1-6(12)9(10,11)7-3-2-4-8(13)5-7/h7H,2-5H2,1H3 |
| InChIKey | SIILBTLWKDBAKM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |