C32H29NO5 — CID 135068298
methyl (2R,3S)-2-[acetyloxy(diphenyl)methyl]-1-(1-naphthalen-1-ylethyl)-4-oxoazetidine-3-carboxylate (PubChem CID 135068298) has the molecular formula C32H29NO5 and a molecular weight of 507.59 g/mol. Its IUPAC name is methyl (2R,3S)-2-[acetyloxy(diphenyl)methyl]-1-(1-naphthalen-1-ylethyl)-4-oxoazetidine-3-carboxylate.
| Compound Name | methyl (2R,3S)-2-[acetyloxy(diphenyl)methyl]-1-(1-naphthalen-1-ylethyl)-4-oxoazetidine-3-carboxylate |
|---|---|
| PubChem CID | 135068298 |
| Molecular Formula | C32H29NO5 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | methyl (2R,3S)-2-[acetyloxy(diphenyl)methyl]-1-(1-naphthalen-1-ylethyl)-4-oxoazetidine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)N(C(C)c2cccc3ccccc23)[C@H]1C(OC(C)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H29NO5/c1-21(26-20-12-14-23-13-10-11-19-27(23)26)33-29(28(30(33)35)31(36)37-3)32(38-22(2)34,24-15-6-4-7-16-24)25-17-8-5-9-18-25/h4-21,28-29H,1-3H3/t21?,28-,29+/m0/s1 |
| InChIKey | HSKCSLNOMQMXIB-BQTLCQCVSA-N |
| XLogP | 5.41 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|