C28H33NO5 — CID 135068034
methyl (2R,3S)-2-[acetyloxy(diphenyl)methyl]-1-(1-cyclohexylethyl)-4-oxoazetidine-3-carboxylate (PubChem CID 135068034) has the molecular formula C28H33NO5 and a molecular weight of 463.57 g/mol. Its IUPAC name is methyl (2R,3S)-2-[acetyloxy(diphenyl)methyl]-1-(1-cyclohexylethyl)-4-oxoazetidine-3-carboxylate.
| Compound Name | methyl (2R,3S)-2-[acetyloxy(diphenyl)methyl]-1-(1-cyclohexylethyl)-4-oxoazetidine-3-carboxylate |
|---|---|
| PubChem CID | 135068034 |
| Molecular Formula | C28H33NO5 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | methyl (2R,3S)-2-[acetyloxy(diphenyl)methyl]-1-(1-cyclohexylethyl)-4-oxoazetidine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)N(C(C)C2CCCCC2)[C@H]1C(OC(C)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H33NO5/c1-19(21-13-7-4-8-14-21)29-25(24(26(29)31)27(32)33-3)28(34-20(2)30,22-15-9-5-10-16-22)23-17-11-6-12-18-23/h5-6,9-12,15-19,21,24-25H,4,7-8,13-14H2,1-3H3/t19?,24-,25+/m0/s1 |
| InChIKey | QWDFPMFQWHGCCC-FQHCJVPLSA-N |
| XLogP | 4.46 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|