C19H36O4Si — CID 135068798
ethyl (2Z)-2-[3-(2-triethylsilylperoxypropan-2-yl)cyclohexylidene]acetate (PubChem CID 135068798) has the molecular formula C19H36O4Si and a molecular weight of 356.58 g/mol. Its IUPAC name is ethyl (2Z)-2-[3-(2-triethylsilylperoxypropan-2-yl)cyclohexylidene]acetate.
| Compound Name | ethyl (2Z)-2-[3-(2-triethylsilylperoxypropan-2-yl)cyclohexylidene]acetate |
|---|---|
| PubChem CID | 135068798 |
| Molecular Formula | C19H36O4Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | ethyl (2Z)-2-[3-(2-triethylsilylperoxypropan-2-yl)cyclohexylidene]acetate |
| SMILES | CCOC(=O)/C=C1/CCCC(C(C)(C)OO[Si](CC)(CC)CC)C1 |
| InChI | InChI=1S/C19H36O4Si/c1-7-21-18(20)15-16-12-11-13-17(14-16)19(5,6)22-23-24(8-2,9-3)10-4/h15,17H,7-14H2,1-6H3/b16-15- |
| InChIKey | MGISGHMUILQINQ-NXVVXOECSA-N |
| XLogP | 5.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|