C16H22O3S — CID 135068801
[(1S,4R)-4-(phenylsulfanylmethyl)-2,3-dioxaspiro[4.5]decan-1-yl]methanol (PubChem CID 135068801) has the molecular formula C16H22O3S and a molecular weight of 294.42 g/mol. Its IUPAC name is [(1S,4R)-4-(phenylsulfanylmethyl)-2,3-dioxaspiro[4.5]decan-1-yl]methanol.
| Compound Name | [(1S,4R)-4-(phenylsulfanylmethyl)-2,3-dioxaspiro[4.5]decan-1-yl]methanol |
|---|---|
| PubChem CID | 135068801 |
| Molecular Formula | C16H22O3S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | [(1S,4R)-4-(phenylsulfanylmethyl)-2,3-dioxaspiro[4.5]decan-1-yl]methanol |
| SMILES | OC[C@H]1OO[C@@H](CSc2ccccc2)C12CCCCC2 |
| InChI | InChI=1S/C16H22O3S/c17-11-14-16(9-5-2-6-10-16)15(19-18-14)12-20-13-7-3-1-4-8-13/h1,3-4,7-8,14-15,17H,2,5-6,9-12H2/t14-,15+/m1/s1 |
| InChIKey | QBYMJPHSMYAIBW-CABCVRRESA-N |
| XLogP | 3.42 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|