C19H20O3S — CID 135068847
6-methoxy-4-methyl-6-[(2Z)-3-phenylsulfanylpenta-2,4-dienoxy]cyclohexa-2,4-dien-1-one (PubChem CID 135068847) has the molecular formula C19H20O3S and a molecular weight of 328.43 g/mol. Its IUPAC name is 6-methoxy-4-methyl-6-[(2Z)-3-phenylsulfanylpenta-2,4-dienoxy]cyclohexa-2,4-dien-1-one.
| Compound Name | 6-methoxy-4-methyl-6-[(2Z)-3-phenylsulfanylpenta-2,4-dienoxy]cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 135068847 |
| Molecular Formula | C19H20O3S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 6-methoxy-4-methyl-6-[(2Z)-3-phenylsulfanylpenta-2,4-dienoxy]cyclohexa-2,4-dien-1-one |
| SMILES | C=C/C(=C/COC1(OC)C=C(C)C=CC1=O)Sc1ccccc1 |
| InChI | InChI=1S/C19H20O3S/c1-4-16(23-17-8-6-5-7-9-17)12-13-22-19(21-3)14-15(2)10-11-18(19)20/h4-12,14H,1,13H2,2-3H3/b16-12- |
| InChIKey | JAJPGZWJFQNZNR-VBKFSLOCSA-N |
| XLogP | 4.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|