C11H16O4 — CID 135069048
(3R,4aR,7aS)-3-ethenyl-7a-hydroxy-3,4a-dimethyl-6,7-dihydro-4H-cyclopenta[c][1,2]dioxin-5-one (PubChem CID 135069048) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is (3R,4aR,7aS)-3-ethenyl-7a-hydroxy-3,4a-dimethyl-6,7-dihydro-4H-cyclopenta[c][1,2]dioxin-5-one.
| Compound Name | (3R,4aR,7aS)-3-ethenyl-7a-hydroxy-3,4a-dimethyl-6,7-dihydro-4H-cyclopenta[c][1,2]dioxin-5-one |
|---|---|
| PubChem CID | 135069048 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (3R,4aR,7aS)-3-ethenyl-7a-hydroxy-3,4a-dimethyl-6,7-dihydro-4H-cyclopenta[c][1,2]dioxin-5-one |
| SMILES | C=C[C@@]1(C)C[C@]2(C)C(=O)CC[C@]2(O)OO1 |
| InChI | InChI=1S/C11H16O4/c1-4-9(2)7-10(3)8(12)5-6-11(10,13)15-14-9/h4,13H,1,5-7H2,2-3H3/t9-,10+,11-/m0/s1 |
| InChIKey | MQLPTFMKCLWXAN-AXFHLTTASA-N |
| XLogP | 1.34 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|