C11H16O — CID 131204388
(7aS)-3a,7a-dimethyl-2,3,6,7-tetrahydroinden-1-one (PubChem CID 131204388) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is (7aS)-3a,7a-dimethyl-2,3,6,7-tetrahydroinden-1-one.
| Compound Name | (7aS)-3a,7a-dimethyl-2,3,6,7-tetrahydroinden-1-one |
|---|---|
| PubChem CID | 131204388 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (7aS)-3a,7a-dimethyl-2,3,6,7-tetrahydroinden-1-one |
| SMILES | CC12C=CCC[C@]1(C)C(=O)CC2 |
| InChI | InChI=1S/C11H16O/c1-10-6-3-4-7-11(10,2)9(12)5-8-10/h3,6H,4-5,7-8H2,1-2H3/t10?,11-/m1/s1 |
| InChIKey | GNHAOAYQIVIPGB-RRKGBCIJSA-N |
| XLogP | 2.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|