C13H22O2Si — CID 24827686
(3aS,7aS)-7a-methyl-3a-trimethylsilyloxy-2,3,6,7-tetrahydroinden-1-one (PubChem CID 24827686) has the molecular formula C13H22O2Si and a molecular weight of 238.40 g/mol. Its IUPAC name is (3aS,7aS)-7a-methyl-3a-trimethylsilyloxy-2,3,6,7-tetrahydroinden-1-one.
| Compound Name | (3aS,7aS)-7a-methyl-3a-trimethylsilyloxy-2,3,6,7-tetrahydroinden-1-one |
|---|---|
| PubChem CID | 24827686 |
| Molecular Formula | C13H22O2Si |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | (3aS,7aS)-7a-methyl-3a-trimethylsilyloxy-2,3,6,7-tetrahydroinden-1-one |
| SMILES | C[C@]12CCC=C[C@@]1(O[Si](C)(C)C)CCC2=O |
| InChI | InChI=1S/C13H22O2Si/c1-12-8-5-6-9-13(12,10-7-11(12)14)15-16(2,3)4/h6,9H,5,7-8,10H2,1-4H3/t12-,13-/m1/s1 |
| InChIKey | PKWKNSJSPPZJMJ-CHWSQXEVSA-N |
| XLogP | 3.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|