C12H14O3 — CID 177485233
(3aR,6aS,9aS)-6a-methyl-3a,6,8,9-tetrahydro-3H-cyclopenta[h][1]benzofuran-2,7-dione (PubChem CID 177485233) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is (3aR,6aS,9aS)-6a-methyl-3a,6,8,9-tetrahydro-3H-cyclopenta[h][1]benzofuran-2,7-dione.
| Compound Name | (3aR,6aS,9aS)-6a-methyl-3a,6,8,9-tetrahydro-3H-cyclopenta[h][1]benzofuran-2,7-dione |
|---|---|
| PubChem CID | 177485233 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (3aR,6aS,9aS)-6a-methyl-3a,6,8,9-tetrahydro-3H-cyclopenta[h][1]benzofuran-2,7-dione |
| SMILES | C[C@]12CC=C[C@H]3CC(=O)O[C@@]31CCC2=O |
| InChI | InChI=1S/C12H14O3/c1-11-5-2-3-8-7-10(14)15-12(8,11)6-4-9(11)13/h2-3,8H,4-7H2,1H3/t8-,11+,12-/m0/s1 |
| InChIKey | XHBQDMOVFXCWKB-AXTRIDKLSA-N |
| XLogP | 1.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|