C11H18O2 — CID 134895807
(4aR,8aS)-8a-hydroperoxy-4a-methyl-1,2,3,4,5,6-hexahydronaphthalene (PubChem CID 134895807) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (4aR,8aS)-8a-hydroperoxy-4a-methyl-1,2,3,4,5,6-hexahydronaphthalene.
| Compound Name | (4aR,8aS)-8a-hydroperoxy-4a-methyl-1,2,3,4,5,6-hexahydronaphthalene |
|---|---|
| PubChem CID | 134895807 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (4aR,8aS)-8a-hydroperoxy-4a-methyl-1,2,3,4,5,6-hexahydronaphthalene |
| SMILES | C[C@@]12CCC=C[C@@]1(OO)CCCC2 |
| InChI | InChI=1S/C11H18O2/c1-10-6-2-4-8-11(10,13-12)9-5-3-7-10/h4,8,12H,2-3,5-7,9H2,1H3/t10-,11+/m0/s1 |
| InChIKey | NZJZZAMOUWKPEU-WDEREUQCSA-N |
| XLogP | 3.15 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|