C12H20 — CID 14339064
(4aS,8aR)-4a,8a-dimethyl-1,2,3,4,5,6-hexahydronaphthalene (PubChem CID 14339064) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is (4aS,8aR)-4a,8a-dimethyl-1,2,3,4,5,6-hexahydronaphthalene.
| Compound Name | (4aS,8aR)-4a,8a-dimethyl-1,2,3,4,5,6-hexahydronaphthalene |
|---|---|
| PubChem CID | 14339064 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | (4aS,8aR)-4a,8a-dimethyl-1,2,3,4,5,6-hexahydronaphthalene |
| SMILES | C[C@]12CCC=C[C@@]1(C)CCCC2 |
| InChI | InChI=1S/C12H20/c1-11-7-3-5-9-12(11,2)10-6-4-8-11/h3,7H,4-6,8-10H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | XNZZQVHNUKVINZ-NWDGAFQWSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|