C21H34 — CID 141409327
5-methyl-2,5-bis(1-methylcyclohexyl)cyclohexa-1,3-diene (PubChem CID 141409327) has the molecular formula C21H34 and a molecular weight of 286.50 g/mol. Its IUPAC name is 5-methyl-2,5-bis(1-methylcyclohexyl)cyclohexa-1,3-diene.
| Compound Name | 5-methyl-2,5-bis(1-methylcyclohexyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 141409327 |
| Molecular Formula | C21H34 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.27 |
| IUPAC Name | 5-methyl-2,5-bis(1-methylcyclohexyl)cyclohexa-1,3-diene |
| SMILES | CC1(C2=CCC(C)(C3(C)CCCCC3)C=C2)CCCCC1 |
| InChI | InChI=1S/C21H34/c1-19(12-6-4-7-13-19)18-10-16-21(3,17-11-18)20(2)14-8-5-9-15-20/h10-11,16H,4-9,12-15,17H2,1-3H3 |
| InChIKey | KYEXRUQLQILYRK-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |