C24H39P3 — CID 15488402
2,4,6-tris(1-methylcyclohexyl)-1,3,5-triphosphinine (PubChem CID 15488402) has the molecular formula C24H39P3 and a molecular weight of 420.50 g/mol. Its IUPAC name is 2,4,6-tris(1-methylcyclohexyl)-1,3,5-triphosphinine.
| Compound Name | 2,4,6-tris(1-methylcyclohexyl)-1,3,5-triphosphinine |
|---|---|
| PubChem CID | 15488402 |
| Molecular Formula | C24H39P3 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 2,4,6-tris(1-methylcyclohexyl)-1,3,5-triphosphinine |
| SMILES | CC1(c2pc(C3(C)CCCCC3)pc(C3(C)CCCCC3)p2)CCCCC1 |
| InChI | InChI=1S/C24H39P3/c1-22(13-7-4-8-14-22)19-25-20(23(2)15-9-5-10-16-23)27-21(26-19)24(3)17-11-6-12-18-24/h4-18H2,1-3H3 |
| InChIKey | PKRRVBPORCBZRH-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |