C18H22F3NO4 — CID 135069490
ethyl (4S)-4-(4-methoxy-N-(2,2,2-trifluoroacetyl)anilino)-4-methylhex-5-enoate (PubChem CID 135069490) has the molecular formula C18H22F3NO4 and a molecular weight of 373.37 g/mol. Its IUPAC name is ethyl (4S)-4-(4-methoxy-N-(2,2,2-trifluoroacetyl)anilino)-4-methylhex-5-enoate.
| Compound Name | ethyl (4S)-4-(4-methoxy-N-(2,2,2-trifluoroacetyl)anilino)-4-methylhex-5-enoate |
|---|---|
| PubChem CID | 135069490 |
| Molecular Formula | C18H22F3NO4 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | ethyl (4S)-4-(4-methoxy-N-(2,2,2-trifluoroacetyl)anilino)-4-methylhex-5-enoate |
| SMILES | C=C[C@](C)(CCC(=O)OCC)N(C(=O)C(F)(F)F)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H22F3NO4/c1-5-17(3,12-11-15(23)26-6-2)22(16(24)18(19,20)21)13-7-9-14(25-4)10-8-13/h5,7-10H,1,6,11-12H2,2-4H3/t17-/m1/s1 |
| InChIKey | FXPQENYWMWRGNW-QGZVFWFLSA-N |
| XLogP | 3.88 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|