C30H32O6 — CID 135069642
(5S,7R,8R)-7-methoxy-8,9,10-tris(phenylmethoxy)-1,6-dioxaspiro[4.5]dec-2-ene (PubChem CID 135069642) has the molecular formula C30H32O6 and a molecular weight of 488.58 g/mol. Its IUPAC name is (5S,7R,8R)-7-methoxy-8,9,10-tris(phenylmethoxy)-1,6-dioxaspiro[4.5]dec-2-ene.
| Compound Name | (5S,7R,8R)-7-methoxy-8,9,10-tris(phenylmethoxy)-1,6-dioxaspiro[4.5]dec-2-ene |
|---|---|
| PubChem CID | 135069642 |
| Molecular Formula | C30H32O6 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | (5S,7R,8R)-7-methoxy-8,9,10-tris(phenylmethoxy)-1,6-dioxaspiro[4.5]dec-2-ene |
| SMILES | CO[C@@H]1O[C@@]2(CC=CO2)C(OCc2ccccc2)C(OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C30H32O6/c1-31-29-27(33-21-24-14-7-3-8-15-24)26(32-20-23-12-5-2-6-13-23)28(30(36-29)18-11-19-35-30)34-22-25-16-9-4-10-17-25/h2-17,19,26-29H,18,20-22H2,1H3/t26?,27-,28?,29-,30+/m1/s1 |
| InChIKey | JGVAHWYMJVPPBN-BUJATHQBSA-N |
| XLogP | 5.38 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |