C18H16O6 — CID 135071035
3-acetyl-3-(3,4-dihydroxy-2-methoxyphenyl)-4H-chromen-2-one (PubChem CID 135071035) has the molecular formula C18H16O6 and a molecular weight of 328.32 g/mol. Its IUPAC name is 3-acetyl-3-(3,4-dihydroxy-2-methoxyphenyl)-4H-chromen-2-one.
| Compound Name | 3-acetyl-3-(3,4-dihydroxy-2-methoxyphenyl)-4H-chromen-2-one |
|---|---|
| PubChem CID | 135071035 |
| Molecular Formula | C18H16O6 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 3-acetyl-3-(3,4-dihydroxy-2-methoxyphenyl)-4H-chromen-2-one |
| SMILES | COc1c(C2(C(C)=O)Cc3ccccc3OC2=O)ccc(O)c1O |
| InChI | InChI=1S/C18H16O6/c1-10(19)18(12-7-8-13(20)15(21)16(12)23-2)9-11-5-3-4-6-14(11)24-17(18)22/h3-8,20-21H,9H2,1-2H3 |
| InChIKey | XTFDSZUTECLQHW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|