C19H17FO7 — CID 102227903
ethyl 3-(3,4-dihydroxy-5-methoxyphenyl)-6-fluoro-2-oxo-4H-chromene-3-carboxylate (PubChem CID 102227903) has the molecular formula C19H17FO7 and a molecular weight of 376.34 g/mol. Its IUPAC name is ethyl 3-(3,4-dihydroxy-5-methoxyphenyl)-6-fluoro-2-oxo-4H-chromene-3-carboxylate.
| Compound Name | ethyl 3-(3,4-dihydroxy-5-methoxyphenyl)-6-fluoro-2-oxo-4H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 102227903 |
| Molecular Formula | C19H17FO7 |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | ethyl 3-(3,4-dihydroxy-5-methoxyphenyl)-6-fluoro-2-oxo-4H-chromene-3-carboxylate |
| SMILES | CCOC(=O)C1(c2cc(O)c(O)c(OC)c2)Cc2cc(F)ccc2OC1=O |
| InChI | InChI=1S/C19H17FO7/c1-3-26-17(23)19(11-7-13(21)16(22)15(8-11)25-2)9-10-6-12(20)4-5-14(10)27-18(19)24/h4-8,21-22H,3,9H2,1-2H3 |
| InChIKey | SXACLHICCSARNS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|