C21H21BrO6 — CID 101444361
tert-butyl 6-bromo-2-(3,4-dihydroxy-5-methoxyphenyl)-3-oxo-1H-indene-2-carboxylate (PubChem CID 101444361) has the molecular formula C21H21BrO6 and a molecular weight of 449.30 g/mol. Its IUPAC name is tert-butyl 6-bromo-2-(3,4-dihydroxy-5-methoxyphenyl)-3-oxo-1H-indene-2-carboxylate.
| Compound Name | tert-butyl 6-bromo-2-(3,4-dihydroxy-5-methoxyphenyl)-3-oxo-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 101444361 |
| Molecular Formula | C21H21BrO6 |
| Molecular Weight | 449.30 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | tert-butyl 6-bromo-2-(3,4-dihydroxy-5-methoxyphenyl)-3-oxo-1H-indene-2-carboxylate |
| SMILES | COc1cc(C2(C(=O)OC(C)(C)C)Cc3cc(Br)ccc3C2=O)cc(O)c1O |
| InChI | InChI=1S/C21H21BrO6/c1-20(2,3)28-19(26)21(12-8-15(23)17(24)16(9-12)27-4)10-11-7-13(22)5-6-14(11)18(21)25/h5-9,23-24H,10H2,1-4H3 |
| InChIKey | AAEAEXCNYGMJBJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|