About 2-phenylethyl bis(trimethylsilyl) phosphite
2-phenylethyl bis(trimethylsilyl) phosphite (PubChem CID 135071839) has the molecular formula C14H27O3PSi2
and a molecular weight of 330.51 g/mol. Its IUPAC name is 2-phenylethyl bis(trimethylsilyl) phosphite.
Molecular Properties
| Compound Name | 2-phenylethyl bis(trimethylsilyl) phosphite |
| PubChem CID | 135071839 |
| Molecular Formula | C14H27O3PSi2 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 2-phenylethyl bis(trimethylsilyl) phosphite |
| SMILES | C[Si](C)(C)OP(OCCc1ccccc1)O[Si](C)(C)C |
| InChI | InChI=1S/C14H27O3PSi2/c1-19(2,3)16-18(17-20(4,5)6)15-13-12-14-10-8-7-9-11-14/h7-11H,12-13H2,1-6H3 |
| InChIKey | AVOCVZOGAHQHBH-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethyl bis(trimethylsilyl) phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethyl bis(trimethylsilyl) phosphite?
The IUPAC name of 2-phenylethyl bis(trimethylsilyl) phosphite (CID 135071839) is 2-phenylethyl bis(trimethylsilyl) phosphite.
What is the SMILES notation for 2-phenylethyl bis(trimethylsilyl) phosphite?
The canonical SMILES for 2-phenylethyl bis(trimethylsilyl) phosphite is C[Si](C)(C)OP(OCCc1ccccc1)O[Si](C)(C)C.
What is the InChIKey of 2-phenylethyl bis(trimethylsilyl) phosphite?
The InChIKey is AVOCVZOGAHQHBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27O3PSi2/c1-19(2,3)16-18(17-20(4,5)6)15-13-12-14-10-8-7-9-11-14/h7-11H,12-13H2,1-6H3.
What are the key properties of 2-phenylethyl bis(trimethylsilyl) phosphite?
2-phenylethyl bis(trimethylsilyl) phosphite has a molecular weight of 330.51 g/mol, XLogP of 5.18, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethyl bis(trimethylsilyl) phosphite is sourced from PubChem (CID 135071839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).