C22H34O3 — CID 135072249
(4S,5R)-4-butyl-5-(6-ethenyl-6-methylcyclohexen-1-yl)-4-(2-methylpent-4-en-2-yl)-1,3-dioxolan-2-one (PubChem CID 135072249) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is (4S,5R)-4-butyl-5-(6-ethenyl-6-methylcyclohexen-1-yl)-4-(2-methylpent-4-en-2-yl)-1,3-dioxolan-2-one.
| Compound Name | (4S,5R)-4-butyl-5-(6-ethenyl-6-methylcyclohexen-1-yl)-4-(2-methylpent-4-en-2-yl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 135072249 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | (4S,5R)-4-butyl-5-(6-ethenyl-6-methylcyclohexen-1-yl)-4-(2-methylpent-4-en-2-yl)-1,3-dioxolan-2-one |
| SMILES | C=CCC(C)(C)[C@]1(CCCC)OC(=O)O[C@@H]1C1=CCCCC1(C)C=C |
| InChI | InChI=1S/C22H34O3/c1-7-10-16-22(20(4,5)14-8-2)18(24-19(23)25-22)17-13-11-12-15-21(17,6)9-3/h8-9,13,18H,2-3,7,10-12,14-16H2,1,4-6H3/t18-,21?,22-/m1/s1 |
| InChIKey | MKWDADRVJMYRPV-MCGPBEARSA-N |
| XLogP | 6.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|