C20H26O3 — CID 119078067
(1S,5S,11S,13Z)-11,15,18,18-tetramethyl-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadeca-6,13,15-trien-3-one (PubChem CID 119078067) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is (1S,5S,11S,13Z)-11,15,18,18-tetramethyl-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadeca-6,13,15-trien-3-one.
| Compound Name | (1S,5S,11S,13Z)-11,15,18,18-tetramethyl-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadeca-6,13,15-trien-3-one |
|---|---|
| PubChem CID | 119078067 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (1S,5S,11S,13Z)-11,15,18,18-tetramethyl-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadeca-6,13,15-trien-3-one |
| SMILES | CC1=CC[C@@]23OC(=O)O[C@H]2C2=CCCC[C@@]2(C)C/C=C/1C3(C)C |
| InChI | InChI=1S/C20H26O3/c1-13-8-12-20-16(22-17(21)23-20)15-7-5-6-10-19(15,4)11-9-14(13)18(20,2)3/h7-9,16H,5-6,10-12H2,1-4H3/b14-9-/t16-,19-,20+/m0/s1 |
| InChIKey | ZNSWCQQBYCUDGD-YNMANSGBSA-N |
| XLogP | 5.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|