C20H26O3 — CID 162401116
(2S,6S,8Z,11S)-11-methyl-6-(2-methylpent-3-yn-2-yl)-3,5-dioxatricyclo[9.4.0.02,6]pentadeca-1(15),8-dien-4-one (PubChem CID 162401116) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is (2S,6S,8Z,11S)-11-methyl-6-(2-methylpent-3-yn-2-yl)-3,5-dioxatricyclo[9.4.0.02,6]pentadeca-1(15),8-dien-4-one.
| Compound Name | (2S,6S,8Z,11S)-11-methyl-6-(2-methylpent-3-yn-2-yl)-3,5-dioxatricyclo[9.4.0.02,6]pentadeca-1(15),8-dien-4-one |
|---|---|
| PubChem CID | 162401116 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (2S,6S,8Z,11S)-11-methyl-6-(2-methylpent-3-yn-2-yl)-3,5-dioxatricyclo[9.4.0.02,6]pentadeca-1(15),8-dien-4-one |
| SMILES | CC#CC(C)(C)[C@@]12C/C=C\C[C@]3(C)CCCC=C3[C@@H]1OC(=O)O2 |
| InChI | InChI=1S/C20H26O3/c1-5-11-18(2,3)20-14-9-8-13-19(4)12-7-6-10-15(19)16(20)22-17(21)23-20/h8-10,16H,6-7,12-14H2,1-4H3/b9-8-/t16-,19-,20+/m0/s1 |
| InChIKey | XWEXISBTLONKLZ-YEVCCTSCSA-N |
| XLogP | 4.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|