C22H36O2 — CID 102151779
(2S,6S,8Z,11S)-6-butyl-4,4,7,7,11-pentamethyl-3,5-dioxatricyclo[9.4.0.02,6]pentadeca-1(15),8-diene (PubChem CID 102151779) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is (2S,6S,8Z,11S)-6-butyl-4,4,7,7,11-pentamethyl-3,5-dioxatricyclo[9.4.0.02,6]pentadeca-1(15),8-diene.
| Compound Name | (2S,6S,8Z,11S)-6-butyl-4,4,7,7,11-pentamethyl-3,5-dioxatricyclo[9.4.0.02,6]pentadeca-1(15),8-diene |
|---|---|
| PubChem CID | 102151779 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | (2S,6S,8Z,11S)-6-butyl-4,4,7,7,11-pentamethyl-3,5-dioxatricyclo[9.4.0.02,6]pentadeca-1(15),8-diene |
| SMILES | CCCC[C@@]12OC(C)(C)O[C@H]1C1=CCCC[C@@]1(C)C/C=C\C2(C)C |
| InChI | InChI=1S/C22H36O2/c1-7-8-16-22-18(23-20(4,5)24-22)17-12-9-10-14-21(17,6)15-11-13-19(22,2)3/h11-13,18H,7-10,14-16H2,1-6H3/b13-11-/t18-,21-,22+/m0/s1 |
| InChIKey | QFNIJTIEOOYXDV-CETBGQRBSA-N |
| XLogP | 6.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|