C19H32O5 — CID 10871536
3-[(4R,5S)-5-hexyl-2,2,5-trimethyl-1,3-dioxolan-4-yl]-5-hydroxy-5-propan-2-ylfuran-2-one (PubChem CID 10871536) has the molecular formula C19H32O5 and a molecular weight of 340.46 g/mol. Its IUPAC name is 3-[(4R,5S)-5-hexyl-2,2,5-trimethyl-1,3-dioxolan-4-yl]-5-hydroxy-5-propan-2-ylfuran-2-one.
| Compound Name | 3-[(4R,5S)-5-hexyl-2,2,5-trimethyl-1,3-dioxolan-4-yl]-5-hydroxy-5-propan-2-ylfuran-2-one |
|---|---|
| PubChem CID | 10871536 |
| Molecular Formula | C19H32O5 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 3-[(4R,5S)-5-hexyl-2,2,5-trimethyl-1,3-dioxolan-4-yl]-5-hydroxy-5-propan-2-ylfuran-2-one |
| SMILES | CCCCCC[C@]1(C)OC(C)(C)O[C@@H]1C1=CC(O)(C(C)C)OC1=O |
| InChI | InChI=1S/C19H32O5/c1-7-8-9-10-11-18(6)15(22-17(4,5)24-18)14-12-19(21,13(2)3)23-16(14)20/h12-13,15,21H,7-11H2,1-6H3/t15-,18+,19?/m1/s1 |
| InChIKey | HOXPYSKEZRHPGJ-XSFKQQOJSA-N |
| XLogP | 3.69 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|