C22H32O4 — CID 135074958
(4S)-4-methyl-5-(3-methyl-2-methylidenebutyl)-4-[(E,3R)-6-methyl-8-prop-2-enoxyoct-6-en-1-yn-3-yl]-1,3-dioxolan-2-one (PubChem CID 135074958) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is (4S)-4-methyl-5-(3-methyl-2-methylidenebutyl)-4-[(E,3R)-6-methyl-8-prop-2-enoxyoct-6-en-1-yn-3-yl]-1,3-dioxolan-2-one.
| Compound Name | (4S)-4-methyl-5-(3-methyl-2-methylidenebutyl)-4-[(E,3R)-6-methyl-8-prop-2-enoxyoct-6-en-1-yn-3-yl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 135074958 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (4S)-4-methyl-5-(3-methyl-2-methylidenebutyl)-4-[(E,3R)-6-methyl-8-prop-2-enoxyoct-6-en-1-yn-3-yl]-1,3-dioxolan-2-one |
| SMILES | C#C[C@@H](CC/C(C)=C/COCC=C)[C@]1(C)OC(=O)OC1CC(=C)C(C)C |
| InChI | InChI=1S/C22H32O4/c1-8-13-24-14-12-17(5)10-11-19(9-2)22(7)20(25-21(23)26-22)15-18(6)16(3)4/h2,8,12,16,19-20H,1,6,10-11,13-15H2,3-5,7H3/b17-12+/t19-,20?,22-/m0/s1 |
| InChIKey | CGKUNAZJXPWZIY-UCIGUZPASA-N |
| XLogP | 5.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|