C25H40O4 — CID 59987637
1-[(1R,2R,6R)-2-[[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-methyl-6-propan-2-ylcyclohex-3-en-1-yl]pent-4-en-2-yl acetate (PubChem CID 59987637) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is 1-[(1R,2R,6R)-2-[[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-methyl-6-propan-2-ylcyclohex-3-en-1-yl]pent-4-en-2-yl acetate.
| Compound Name | 1-[(1R,2R,6R)-2-[[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-methyl-6-propan-2-ylcyclohex-3-en-1-yl]pent-4-en-2-yl acetate |
|---|---|
| PubChem CID | 59987637 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | 1-[(1R,2R,6R)-2-[[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-methyl-6-propan-2-ylcyclohex-3-en-1-yl]pent-4-en-2-yl acetate |
| SMILES | C=CCC(C[C@@H]1[C@@H](C(C)C)CC=C(C)[C@@H]1C[C@@H]1OC(C)(C)O[C@H]1C=C)OC(C)=O |
| InChI | InChI=1S/C25H40O4/c1-9-11-19(27-18(6)26)14-22-20(16(3)4)13-12-17(5)21(22)15-24-23(10-2)28-25(7,8)29-24/h9-10,12,16,19-24H,1-2,11,13-15H2,3-8H3/t19?,20-,21+,22-,23+,24+/m1/s1 |
| InChIKey | KJUOTNVIHRCJCG-ZJGLJZOTSA-N |
| XLogP | 5.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|