C16H17NO4S — CID 135072709
methyl 2-[[(4-methylphenyl)sulfonyl-prop-2-ynylamino]methyl]cycloprop-2-ene-1-carboxylate (PubChem CID 135072709) has the molecular formula C16H17NO4S and a molecular weight of 319.38 g/mol. Its IUPAC name is methyl 2-[[(4-methylphenyl)sulfonyl-prop-2-ynylamino]methyl]cycloprop-2-ene-1-carboxylate.
| Compound Name | methyl 2-[[(4-methylphenyl)sulfonyl-prop-2-ynylamino]methyl]cycloprop-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 135072709 |
| Molecular Formula | C16H17NO4S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | methyl 2-[[(4-methylphenyl)sulfonyl-prop-2-ynylamino]methyl]cycloprop-2-ene-1-carboxylate |
| SMILES | C#CCN(CC1=CC1C(=O)OC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H17NO4S/c1-4-9-17(11-13-10-15(13)16(18)21-3)22(19,20)14-7-5-12(2)6-8-14/h1,5-8,10,15H,9,11H2,2-3H3 |
| InChIKey | VJVCUXMUVRVQAC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|