C16H24O4 — CID 135074748
dimethyl 8-but-3-enylspiro[2.5]octane-2,2-dicarboxylate (PubChem CID 135074748) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is dimethyl 8-but-3-enylspiro[2.5]octane-2,2-dicarboxylate.
| Compound Name | dimethyl 8-but-3-enylspiro[2.5]octane-2,2-dicarboxylate |
|---|---|
| PubChem CID | 135074748 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | dimethyl 8-but-3-enylspiro[2.5]octane-2,2-dicarboxylate |
| SMILES | C=CCCC1CCCCC12CC2(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C16H24O4/c1-4-5-8-12-9-6-7-10-15(12)11-16(15,13(17)19-2)14(18)20-3/h4,12H,1,5-11H2,2-3H3 |
| InChIKey | SHIMKINFYWJYHI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|