C16H30OSi — CID 135076235
bis[(Z)-but-2-enyl]-[(3R)-2,4-dimethylhex-5-en-3-yl]oxysilane (PubChem CID 135076235) has the molecular formula C16H30OSi and a molecular weight of 266.50 g/mol. Its IUPAC name is bis[(Z)-but-2-enyl]-[(3R)-2,4-dimethylhex-5-en-3-yl]oxysilane.
| Compound Name | bis[(Z)-but-2-enyl]-[(3R)-2,4-dimethylhex-5-en-3-yl]oxysilane |
|---|---|
| PubChem CID | 135076235 |
| Molecular Formula | C16H30OSi |
| Molecular Weight | 266.50 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | bis[(Z)-but-2-enyl]-[(3R)-2,4-dimethylhex-5-en-3-yl]oxysilane |
| SMILES | C=CC(C)[C@H](O[SiH](C/C=C\C)C/C=C\C)C(C)C |
| InChI | InChI=1S/C16H30OSi/c1-7-10-12-18(13-11-8-2)17-16(14(4)5)15(6)9-3/h7-11,14-16,18H,3,12-13H2,1-2,4-6H3/b10-7-,11-8-/t15?,16-/m1/s1 |
| InChIKey | JGYKYEFXZDVMFS-DRLWUDHLSA-N |
| XLogP | 4.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|