C16H16O3S — CID 135076312
1,1-diphenylprop-1-en-2-yl methanesulfonate (PubChem CID 135076312) has the molecular formula C16H16O3S and a molecular weight of 288.37 g/mol. Its IUPAC name is 1,1-diphenylprop-1-en-2-yl methanesulfonate.
| Compound Name | 1,1-diphenylprop-1-en-2-yl methanesulfonate |
|---|---|
| PubChem CID | 135076312 |
| Molecular Formula | C16H16O3S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 1,1-diphenylprop-1-en-2-yl methanesulfonate |
| SMILES | CC(OS(C)(=O)=O)=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H16O3S/c1-13(19-20(2,17)18)16(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,1-2H3 |
| InChIKey | LMKIQDOCROFDQR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|