C21H22O9S2 — CID 175260933
bis(methylsulfonyl) 2,4-dimethyl-3-oxo-2,4-diphenylpentanedioate (PubChem CID 175260933) has the molecular formula C21H22O9S2 and a molecular weight of 482.53 g/mol. Its IUPAC name is bis(methylsulfonyl) 2,4-dimethyl-3-oxo-2,4-diphenylpentanedioate.
| Compound Name | bis(methylsulfonyl) 2,4-dimethyl-3-oxo-2,4-diphenylpentanedioate |
|---|---|
| PubChem CID | 175260933 |
| Molecular Formula | C21H22O9S2 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | bis(methylsulfonyl) 2,4-dimethyl-3-oxo-2,4-diphenylpentanedioate |
| SMILES | CC(C(=O)OS(C)(=O)=O)(C(=O)C(C)(C(=O)OS(C)(=O)=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H22O9S2/c1-20(15-11-7-5-8-12-15,18(23)29-31(3,25)26)17(22)21(2,16-13-9-6-10-14-16)19(24)30-32(4,27)28/h5-14H,1-4H3 |
| InChIKey | HVUWAFZLDLEFSN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 137.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|