C21H22NOPS — CID 135076568
(E)-N-bis(2,6-dimethylphenyl)phosphoryl-1-thiophen-2-ylmethanimine (PubChem CID 135076568) has the molecular formula C21H22NOPS and a molecular weight of 367.45 g/mol. Its IUPAC name is (E)-N-bis(2,6-dimethylphenyl)phosphoryl-1-thiophen-2-ylmethanimine.
| Compound Name | (E)-N-bis(2,6-dimethylphenyl)phosphoryl-1-thiophen-2-ylmethanimine |
|---|---|
| PubChem CID | 135076568 |
| Molecular Formula | C21H22NOPS |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | (E)-N-bis(2,6-dimethylphenyl)phosphoryl-1-thiophen-2-ylmethanimine |
| SMILES | Cc1cccc(C)c1P(=O)(/N=C/c1cccs1)c1c(C)cccc1C |
| InChI | InChI=1S/C21H22NOPS/c1-15-8-5-9-16(2)20(15)24(23,22-14-19-12-7-13-25-19)21-17(3)10-6-11-18(21)4/h5-14H,1-4H3/b22-14+ |
| InChIKey | VGQLXUJAIILUGU-HYARGMPZSA-N |
| XLogP | 5.33 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|