C28H26N4O3S — CID 1350769
(6R)-9,9-dimethyl-6-(3-nitrophenyl)-7-oxo-N-phenyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-5-carbothioamide (PubChem CID 1350769) has the molecular formula C28H26N4O3S and a molecular weight of 498.61 g/mol. Its IUPAC name is (6R)-9,9-dimethyl-6-(3-nitrophenyl)-7-oxo-N-phenyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-5-carbothioamide.
| Compound Name | (6R)-9,9-dimethyl-6-(3-nitrophenyl)-7-oxo-N-phenyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-5-carbothioamide |
|---|---|
| PubChem CID | 1350769 |
| Molecular Formula | C28H26N4O3S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | (6R)-9,9-dimethyl-6-(3-nitrophenyl)-7-oxo-N-phenyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-5-carbothioamide |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1ccccc1N(C(=S)Nc1ccccc1)[C@@H]2c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H26N4O3S/c1-28(2)16-22-25(24(33)17-28)26(18-9-8-12-20(15-18)32(34)35)31(23-14-7-6-13-21(23)30-22)27(36)29-19-10-4-3-5-11-19/h3-15,26,30H,16-17H2,1-2H3,(H,29,36)/t26-/m1/s1 |
| InChIKey | JHOGYESUDWWVTL-AREMUKBSSA-N |
| XLogP | 6.61 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|