C28H25Cl2N3OS — CID 41030761
(6S)-6-(3,4-dichlorophenyl)-9,9-dimethyl-7-oxo-N-phenyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-5-carbothioamide (PubChem CID 41030761) has the molecular formula C28H25Cl2N3OS and a molecular weight of 522.50 g/mol. Its IUPAC name is (6S)-6-(3,4-dichlorophenyl)-9,9-dimethyl-7-oxo-N-phenyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-5-carbothioamide.
| Compound Name | (6S)-6-(3,4-dichlorophenyl)-9,9-dimethyl-7-oxo-N-phenyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-5-carbothioamide |
|---|---|
| PubChem CID | 41030761 |
| Molecular Formula | C28H25Cl2N3OS |
| Molecular Weight | 522.50 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | (6S)-6-(3,4-dichlorophenyl)-9,9-dimethyl-7-oxo-N-phenyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-5-carbothioamide |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1ccccc1N(C(=S)Nc1ccccc1)[C@H]2c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H25Cl2N3OS/c1-28(2)15-22-25(24(34)16-28)26(17-12-13-19(29)20(30)14-17)33(23-11-7-6-10-21(23)32-22)27(35)31-18-8-4-3-5-9-18/h3-14,26,32H,15-16H2,1-2H3,(H,31,35)/t26-/m0/s1 |
| InChIKey | CLAMJFSJTARIRP-SANMLTNESA-N |
| XLogP | 8.01 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.50 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|