C31H33N3O4S — CID 1350650
(6S)-9,9-dimethyl-7-oxo-N-phenyl-6-(3,4,5-trimethoxyphenyl)-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-5-carbothioamide (PubChem CID 1350650) has the molecular formula C31H33N3O4S and a molecular weight of 543.69 g/mol. Its IUPAC name is (6S)-9,9-dimethyl-7-oxo-N-phenyl-6-(3,4,5-trimethoxyphenyl)-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-5-carbothioamide.
| Compound Name | (6S)-9,9-dimethyl-7-oxo-N-phenyl-6-(3,4,5-trimethoxyphenyl)-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-5-carbothioamide |
|---|---|
| PubChem CID | 1350650 |
| Molecular Formula | C31H33N3O4S |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | (6S)-9,9-dimethyl-7-oxo-N-phenyl-6-(3,4,5-trimethoxyphenyl)-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-5-carbothioamide |
| SMILES | COc1cc([C@H]2C3=C(CC(C)(C)CC3=O)Nc3ccccc3N2C(=S)Nc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C31H33N3O4S/c1-31(2)17-22-27(24(35)18-31)28(19-15-25(36-3)29(38-5)26(16-19)37-4)34(23-14-10-9-13-21(23)33-22)30(39)32-20-11-7-6-8-12-20/h6-16,28,33H,17-18H2,1-5H3,(H,32,39)/t28-/m0/s1 |
| InChIKey | ARFXTIMIICRYDH-NDEPHWFRSA-N |
| XLogP | 6.73 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|