C35H33N3O4S — CID 98454221
(6R,9S)-7-oxo-N,9-diphenyl-6-(3,4,5-trimethoxyphenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepine-5-carbothioamide (PubChem CID 98454221) has the molecular formula C35H33N3O4S and a molecular weight of 591.73 g/mol. Its IUPAC name is (6R,9S)-7-oxo-N,9-diphenyl-6-(3,4,5-trimethoxyphenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepine-5-carbothioamide.
| Compound Name | (6R,9S)-7-oxo-N,9-diphenyl-6-(3,4,5-trimethoxyphenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepine-5-carbothioamide |
|---|---|
| PubChem CID | 98454221 |
| Molecular Formula | C35H33N3O4S |
| Molecular Weight | 591.73 g/mol |
| Exact Mass | 591.22 |
| IUPAC Name | (6R,9S)-7-oxo-N,9-diphenyl-6-(3,4,5-trimethoxyphenyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepine-5-carbothioamide |
| SMILES | COc1cc([C@@H]2C3=C(C[C@H](c4ccccc4)CC3=O)Nc3ccccc3N2C(=S)Nc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C35H33N3O4S/c1-40-30-20-24(21-31(41-2)34(30)42-3)33-32-27(18-23(19-29(32)39)22-12-6-4-7-13-22)37-26-16-10-11-17-28(26)38(33)35(43)36-25-14-8-5-9-15-25/h4-17,20-21,23,33,37H,18-19H2,1-3H3,(H,36,43)/t23-,33+/m0/s1 |
| InChIKey | VCFBTYPZGHHYBO-FLASPHMUSA-N |
| XLogP | 7.48 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.73 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|