C18H26O4 — CID 135077201
tert-butyl (E)-5-(2,6-dioxo-1-prop-2-enylcyclohexyl)pent-2-enoate (PubChem CID 135077201) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is tert-butyl (E)-5-(2,6-dioxo-1-prop-2-enylcyclohexyl)pent-2-enoate.
| Compound Name | tert-butyl (E)-5-(2,6-dioxo-1-prop-2-enylcyclohexyl)pent-2-enoate |
|---|---|
| PubChem CID | 135077201 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | tert-butyl (E)-5-(2,6-dioxo-1-prop-2-enylcyclohexyl)pent-2-enoate |
| SMILES | C=CCC1(CC/C=C/C(=O)OC(C)(C)C)C(=O)CCCC1=O |
| InChI | InChI=1S/C18H26O4/c1-5-12-18(14(19)9-8-10-15(18)20)13-7-6-11-16(21)22-17(2,3)4/h5-6,11H,1,7-10,12-13H2,2-4H3/b11-6+ |
| InChIKey | HBNUDSUKCWZGOL-IZZDOVSWSA-N |
| XLogP | 3.55 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|