C16H22O5 — CID 176555252
1-O-tert-butyl 3-O-methyl 6-oxo-3-prop-2-enylcyclohexene-1,3-dicarboxylate (PubChem CID 176555252) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-methyl 6-oxo-3-prop-2-enylcyclohexene-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-methyl 6-oxo-3-prop-2-enylcyclohexene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 176555252 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 1-O-tert-butyl 3-O-methyl 6-oxo-3-prop-2-enylcyclohexene-1,3-dicarboxylate |
| SMILES | C=CCC1(C(=O)OC)C=C(C(=O)OC(C)(C)C)C(=O)CC1 |
| InChI | InChI=1S/C16H22O5/c1-6-8-16(14(19)20-5)9-7-12(17)11(10-16)13(18)21-15(2,3)4/h6,10H,1,7-9H2,2-5H3 |
| InChIKey | OXBWINVAXZPTON-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|