C26H30NO2P — CID 135077215
2-(2-diphenylphosphanylphenyl)-N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]acetamide (PubChem CID 135077215) has the molecular formula C26H30NO2P and a molecular weight of 419.51 g/mol. Its IUPAC name is 2-(2-diphenylphosphanylphenyl)-N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]acetamide.
| Compound Name | 2-(2-diphenylphosphanylphenyl)-N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 135077215 |
| Molecular Formula | C26H30NO2P |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 2-(2-diphenylphosphanylphenyl)-N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]acetamide |
| SMILES | CC(C)(C)[C@@H](CO)NC(=O)Cc1ccccc1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H30NO2P/c1-26(2,3)24(19-28)27-25(29)18-20-12-10-11-17-23(20)30(21-13-6-4-7-14-21)22-15-8-5-9-16-22/h4-17,24,28H,18-19H2,1-3H3,(H,27,29)/t24-/m1/s1 |
| InChIKey | ZUKQEZVGHPDZHH-XMMPIXPASA-N |
| XLogP | 3.51 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|