C38H46N4O10 — CID 135078300
[5-azido-6-[5-[benzyl(phenylmethoxycarbonyl)amino]pentoxy]-3-hydroxy-4-phenylmethoxyoxan-2-yl]methyl 3-acetyloxypropanoate (PubChem CID 135078300) has the molecular formula C38H46N4O10 and a molecular weight of 718.80 g/mol. Its IUPAC name is [5-azido-6-[5-[benzyl(phenylmethoxycarbonyl)amino]pentoxy]-3-hydroxy-4-phenylmethoxyoxan-2-yl]methyl 3-acetyloxypropanoate.
| Compound Name | [5-azido-6-[5-[benzyl(phenylmethoxycarbonyl)amino]pentoxy]-3-hydroxy-4-phenylmethoxyoxan-2-yl]methyl 3-acetyloxypropanoate |
|---|---|
| PubChem CID | 135078300 |
| Molecular Formula | C38H46N4O10 |
| Molecular Weight | 718.80 g/mol |
| Exact Mass | 718.32 |
| IUPAC Name | [5-azido-6-[5-[benzyl(phenylmethoxycarbonyl)amino]pentoxy]-3-hydroxy-4-phenylmethoxyoxan-2-yl]methyl 3-acetyloxypropanoate |
| SMILES | CC(=O)OCCC(=O)OCC1OC(OCCCCCN(Cc2ccccc2)C(=O)OCc2ccccc2)C(N=[N+]=[N-])C(OCc2ccccc2)C1O |
| InChI | InChI=1S/C38H46N4O10/c1-28(43)47-23-20-33(44)49-27-32-35(45)36(50-25-30-16-8-3-9-17-30)34(40-41-39)37(52-32)48-22-13-5-12-21-42(24-29-14-6-2-7-15-29)38(46)51-26-31-18-10-4-11-19-31/h2-4,6-11,14-19,32,34-37,45H,5,12-13,20-27H2,1H3 |
| InChIKey | WPIQRXONOWINJZ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 178.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.80 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|