C14H16O3 — CID 135078592
(2E,6E)-8-(furan-2-yl)-5,5-dimethyl-8-oxoocta-2,6-dienal (PubChem CID 135078592) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is (2E,6E)-8-(furan-2-yl)-5,5-dimethyl-8-oxoocta-2,6-dienal.
| Compound Name | (2E,6E)-8-(furan-2-yl)-5,5-dimethyl-8-oxoocta-2,6-dienal |
|---|---|
| PubChem CID | 135078592 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | (2E,6E)-8-(furan-2-yl)-5,5-dimethyl-8-oxoocta-2,6-dienal |
| SMILES | CC(C)(/C=C/C(=O)c1ccco1)C/C=C/C=O |
| InChI | InChI=1S/C14H16O3/c1-14(2,8-3-4-10-15)9-7-12(16)13-6-5-11-17-13/h3-7,9-11H,8H2,1-2H3/b4-3+,9-7+ |
| InChIKey | QQXTXSURWUYLJU-DQTVNRMBSA-N |
| XLogP | 3.19 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|