C20H34INO2 — CID 135078769
(E)-1-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]-14-iodotetradec-2-ene-1,4-dione (PubChem CID 135078769) has the molecular formula C20H34INO2 and a molecular weight of 447.40 g/mol. Its IUPAC name is (E)-1-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]-14-iodotetradec-2-ene-1,4-dione.
| Compound Name | (E)-1-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]-14-iodotetradec-2-ene-1,4-dione |
|---|---|
| PubChem CID | 135078769 |
| Molecular Formula | C20H34INO2 |
| Molecular Weight | 447.40 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | (E)-1-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]-14-iodotetradec-2-ene-1,4-dione |
| SMILES | C[C@@H]1CC[C@@H](C)N1C(=O)/C=C/C(=O)CCCCCCCCCCI |
| InChI | InChI=1S/C20H34INO2/c1-17-12-13-18(2)22(17)20(24)15-14-19(23)11-9-7-5-3-4-6-8-10-16-21/h14-15,17-18H,3-13,16H2,1-2H3/b15-14+/t17-,18-/m1/s1 |
| InChIKey | FXHPWALISMQJLG-NVGHFZOBSA-N |
| XLogP | 5.46 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.40 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|