C16H25NO2 — CID 141060682
(5R)-1-[(Z)-but-2-enyl]-5-[(E)-3-oxooct-1-enyl]pyrrolidin-2-one (PubChem CID 141060682) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is (5R)-1-[(Z)-but-2-enyl]-5-[(E)-3-oxooct-1-enyl]pyrrolidin-2-one.
| Compound Name | (5R)-1-[(Z)-but-2-enyl]-5-[(E)-3-oxooct-1-enyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 141060682 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | (5R)-1-[(Z)-but-2-enyl]-5-[(E)-3-oxooct-1-enyl]pyrrolidin-2-one |
| SMILES | C/C=C\CN1C(=O)CC[C@@H]1/C=C/C(=O)CCCCC |
| InChI | InChI=1S/C16H25NO2/c1-3-5-7-8-15(18)11-9-14-10-12-16(19)17(14)13-6-4-2/h4,6,9,11,14H,3,5,7-8,10,12-13H2,1-2H3/b6-4-,11-9+/t14-/m0/s1 |
| InChIKey | KVTBIEFMFINHRX-NEDBIJTJSA-N |
| XLogP | 3.26 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|