C17H34OSi2 — CID 135078784
tert-butyl-dimethyl-[(Z)-8-trimethylsilyloct-5-en-7-ynoxy]silane (PubChem CID 135078784) has the molecular formula C17H34OSi2 and a molecular weight of 310.63 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(Z)-8-trimethylsilyloct-5-en-7-ynoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(Z)-8-trimethylsilyloct-5-en-7-ynoxy]silane |
|---|---|
| PubChem CID | 135078784 |
| Molecular Formula | C17H34OSi2 |
| Molecular Weight | 310.63 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | tert-butyl-dimethyl-[(Z)-8-trimethylsilyloct-5-en-7-ynoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC/C=C\C#C[Si](C)(C)C |
| InChI | InChI=1S/C17H34OSi2/c1-17(2,3)20(7,8)18-15-13-11-9-10-12-14-16-19(4,5)6/h10,12H,9,11,13,15H2,1-8H3/b12-10- |
| InChIKey | PXRVZQYJPRZPPT-BENRWUELSA-N |
| XLogP | 5.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.63 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|