C17H15F2NO3 — CID 135079110
ethyl 2-(3,5-difluorophenyl)-2-(4-methoxyphenyl)iminoacetate (PubChem CID 135079110) has the molecular formula C17H15F2NO3 and a molecular weight of 319.31 g/mol. Its IUPAC name is ethyl 2-(3,5-difluorophenyl)-2-(4-methoxyphenyl)iminoacetate.
| Compound Name | ethyl 2-(3,5-difluorophenyl)-2-(4-methoxyphenyl)iminoacetate |
|---|---|
| PubChem CID | 135079110 |
| Molecular Formula | C17H15F2NO3 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | ethyl 2-(3,5-difluorophenyl)-2-(4-methoxyphenyl)iminoacetate |
| SMILES | CCOC(=O)/C(=N\c1ccc(OC)cc1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C17H15F2NO3/c1-3-23-17(21)16(11-8-12(18)10-13(19)9-11)20-14-4-6-15(22-2)7-5-14/h4-10H,3H2,1-2H3/b20-16- |
| InChIKey | NEHIOPMORSNEHS-SILNSSARSA-N |
| XLogP | 3.66 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|